| Name | (Z)-2-methylbut-2-enoate |
| Synonyms | ANGELIC ANHYDRIDE Angelic anhydride (Z)-2-methylbut-2-enoyl (Z)-2-methylbut-2-enoate Angelic anhydride 94487-74-8 2-METHYLISOCROTONIC ANHYDRIDE CIS-2-METHYLCROTONIC ANHYDRIDE (Z)-2-METHYL-2-BUTENOIC ANHYDRIDE CIS-2,3-DIMETHYLACRYLIC ANHYDRIDE (2Z)-2-Methylbut-2-enoic anhydride Bis[(Z)-2-methyl-2-butenoic] anhydride Bis[(Z)-2-methyl-2-butenoic acid] anhydride |
| CAS | 94487-74-8 |
| InChI | InChI=1/C10H14O3/c1-5-7(3)9(11)13-10(12)8(4)6-2/h5-6H,1-4H3/b7-5-,8-6- |
| InChIKey | LIHLSLRANKCHLV-SFECMWDFSA-N |
| Molecular Formula | C10H14O3 |
| Molar Mass | 182.22 |
| Density | 1,02 g/cm3 |
| Boling Point | 108 °C / 13mmHg |
| Flash Point | 119.788°C |
| Solubility | Slightly soluble (1.2g/L) (25°C) |
| Vapor Presure | 0.004mmHg at 25°C |
| Appearance | Liquid |
| Color | Colorless to Light orange to Yellow |
| Storage Condition | 0-10°C |
| Refractive Index | 1.4720-1.4750 |
| MDL | MFCD00198080 |
| UN IDs | 3265 |
| Hazard Class | 8 |
| Packing Group | III |
| Overview | angelicae dahuricae anhydride is useful as an intermediate in the synthesis of pharmaceuticals. If inhaling the acid, move the patient to fresh air; If the skin is in contact, remove the contaminated clothing and rinse the skin thoroughly with soap and water; if the eyes are in contact, the eyelids should be separated, washed with running water or normal saline, and immediately seek medical treatment; If you eat, immediately rinse, do not emesis, should immediately seek medical treatment. |
| preparation | the preparation of Angelica anhydride (angelicae dahuricae anhydride) is as follows: at room temperature, to Angelica acid (5G, 50mmol) of dichloromethane (100mL) solution added N,N '? Dicyclohexylcarbodiimide (8.6mL,60% in xylene, 25mmol). The reaction mixture was stirred at this temperature for 1 hour. The precipitate was filtered. The filtrate was concentrated in vacuo. The residue was purified by chromatography (petroleum ether/ethyl acetate 10:1) to give 94% G of the title compound Angelica dahurica anhydride as an oil (). 1HNMR(300MHz,CDCl3) = 6.37? 6.25(m,2H),2.06(dq,J=7.4,1.5 Hz,6H),1.97? 1.93(m,6h). |
| biological activity | Angelic anhydride is a fatty anhydride derived from unsaturated hydrocarbon anhydrides. |